C20H24N2O — CID 26458129
(3R)-1-(2,2-diphenylethyl)piperidine-3-carboxamide (PubChem CID 26458129) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (3R)-1-(2,2-diphenylethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(2,2-diphenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26458129 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (3R)-1-(2,2-diphenylethyl)piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H24N2O/c21-20(23)18-12-7-13-22(14-18)15-19(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,18-19H,7,12-15H2,(H2,21,23)/t18-/m1/s1 |
| InChIKey | JWKJGHUMYCDKBL-GOSISDBHSA-N |
| XLogP | 3.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |