C20H23NO — CID 18665738
(3S)-1-(2,2-diphenylethyl)piperidine-3-carbaldehyde (PubChem CID 18665738) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (3S)-1-(2,2-diphenylethyl)piperidine-3-carbaldehyde.
| Compound Name | (3S)-1-(2,2-diphenylethyl)piperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 18665738 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (3S)-1-(2,2-diphenylethyl)piperidine-3-carbaldehyde |
| SMILES | O=C[C@H]1CCCN(CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H23NO/c22-16-17-8-7-13-21(14-17)15-20(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-6,9-12,16-17,20H,7-8,13-15H2/t17-/m0/s1 |
| InChIKey | IHIWAOIEVACKJC-KRWDZBQOSA-N |
| XLogP | 3.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|