C14H19NO — CID 62654379
1-[(2-methylphenyl)methyl]piperidine-3-carbaldehyde (PubChem CID 62654379) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]piperidine-3-carbaldehyde.
| Compound Name | 1-[(2-methylphenyl)methyl]piperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 62654379 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]piperidine-3-carbaldehyde |
| SMILES | Cc1ccccc1CN1CCCC(C=O)C1 |
| InChI | InChI=1S/C14H19NO/c1-12-5-2-3-7-14(12)10-15-8-4-6-13(9-15)11-16/h2-3,5,7,11,13H,4,6,8-10H2,1H3 |
| InChIKey | WMRYUQMYTMEFNS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|