C11H16ClN — CID 166756979
1-[(2-methylphenyl)methyl]azetidine;hydrochloride (PubChem CID 166756979) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]azetidine;hydrochloride.
| Compound Name | 1-[(2-methylphenyl)methyl]azetidine;hydrochloride |
|---|---|
| PubChem CID | 166756979 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]azetidine;hydrochloride |
| SMILES | Cc1ccccc1CN1CCC1.Cl |
| InChI | InChI=1S/C11H15N.ClH/c1-10-5-2-3-6-11(10)9-12-7-4-8-12;/h2-3,5-6H,4,7-9H2,1H3;1H |
| InChIKey | KDIQPCDLXCCQGN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |