C21H27ClN2O — CID 12806265
N-(2,6-dimethylphenyl)-2-(piperidin-1-ylmethyl)benzamide;hydrochloride (PubChem CID 12806265) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(piperidin-1-ylmethyl)benzamide;hydrochloride.
| Compound Name | N-(2,6-dimethylphenyl)-2-(piperidin-1-ylmethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 12806265 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(piperidin-1-ylmethyl)benzamide;hydrochloride |
| SMILES | Cc1cccc(C)c1NC(=O)c1ccccc1CN1CCCCC1.Cl |
| InChI | InChI=1S/C21H26N2O.ClH/c1-16-9-8-10-17(2)20(16)22-21(24)19-12-5-4-11-18(19)15-23-13-6-3-7-14-23;/h4-5,8-12H,3,6-7,13-15H2,1-2H3,(H,22,24);1H |
| InChIKey | MAFIEINHKQMDPA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |