C21H25NO — CID 24725201
(3,4-dimethylphenyl)-[2-(piperidin-1-ylmethyl)phenyl]methanone (PubChem CID 24725201) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-[2-(piperidin-1-ylmethyl)phenyl]methanone.
| Compound Name | (3,4-dimethylphenyl)-[2-(piperidin-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 24725201 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3,4-dimethylphenyl)-[2-(piperidin-1-ylmethyl)phenyl]methanone |
| SMILES | Cc1ccc(C(=O)c2ccccc2CN2CCCCC2)cc1C |
| InChI | InChI=1S/C21H25NO/c1-16-10-11-18(14-17(16)2)21(23)20-9-5-4-8-19(20)15-22-12-6-3-7-13-22/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3 |
| InChIKey | RYEVGRQTJLVVBB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |