C18H17BrFNO — CID 24725260
(4-bromo-3-fluorophenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone (PubChem CID 24725260) has the molecular formula C18H17BrFNO and a molecular weight of 362.24 g/mol. Its IUPAC name is (4-bromo-3-fluorophenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone.
| Compound Name | (4-bromo-3-fluorophenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 24725260 |
| Molecular Formula | C18H17BrFNO |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (4-bromo-3-fluorophenyl)-[2-(pyrrolidin-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(Br)c(F)c1)c1ccccc1CN1CCCC1 |
| InChI | InChI=1S/C18H17BrFNO/c19-16-8-7-13(11-17(16)20)18(22)15-6-2-1-5-14(15)12-21-9-3-4-10-21/h1-2,5-8,11H,3-4,9-10,12H2 |
| InChIKey | KPQWNNZFDLFGCK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |