C19H20BrFN2O — CID 24725495
(4-bromo-2-fluorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone (PubChem CID 24725495) has the molecular formula C19H20BrFN2O and a molecular weight of 391.28 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone.
| Compound Name | (4-bromo-2-fluorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 24725495 |
| Molecular Formula | C19H20BrFN2O |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (4-bromo-2-fluorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone |
| SMILES | CN1CCN(Cc2ccccc2C(=O)c2ccc(Br)cc2F)CC1 |
| InChI | InChI=1S/C19H20BrFN2O/c1-22-8-10-23(11-9-22)13-14-4-2-3-5-16(14)19(24)17-7-6-15(20)12-18(17)21/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | BXBKUZOKOJPCNS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |