C19H19F2NO — CID 24725221
(3,4-difluorophenyl)-[2-(piperidin-1-ylmethyl)phenyl]methanone (PubChem CID 24725221) has the molecular formula C19H19F2NO and a molecular weight of 315.36 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[2-(piperidin-1-ylmethyl)phenyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[2-(piperidin-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 24725221 |
| Molecular Formula | C19H19F2NO |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (3,4-difluorophenyl)-[2-(piperidin-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)c1ccccc1CN1CCCCC1 |
| InChI | InChI=1S/C19H19F2NO/c20-17-9-8-14(12-18(17)21)19(23)16-7-3-2-6-15(16)13-22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2 |
| InChIKey | XDLNBUNIWMBRHL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |