C21H24F2N4O2 — CID 52502701
2-[(Z)-[amino-[2-(piperidin-1-ylmethyl)phenyl]methylidene]amino]oxy-N-(3,4-difluorophenyl)acetamide (PubChem CID 52502701) has the molecular formula C21H24F2N4O2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[(Z)-[amino-[2-(piperidin-1-ylmethyl)phenyl]methylidene]amino]oxy-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-[(Z)-[amino-[2-(piperidin-1-ylmethyl)phenyl]methylidene]amino]oxy-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 52502701 |
| Molecular Formula | C21H24F2N4O2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[(Z)-[amino-[2-(piperidin-1-ylmethyl)phenyl]methylidene]amino]oxy-N-(3,4-difluorophenyl)acetamide |
| SMILES | N/C(=N\OCC(=O)Nc1ccc(F)c(F)c1)c1ccccc1CN1CCCCC1 |
| InChI | InChI=1S/C21H24F2N4O2/c22-18-9-8-16(12-19(18)23)25-20(28)14-29-26-21(24)17-7-3-2-6-15(17)13-27-10-4-1-5-11-27/h2-3,6-9,12H,1,4-5,10-11,13-14H2,(H2,24,26)(H,25,28) |
| InChIKey | YLWHBSICGWISET-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|