C16H22N2O3 — CID 10891589
methyl (2E)-2-methoxyimino-2-[2-(piperidin-1-ylmethyl)phenyl]acetate (PubChem CID 10891589) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl (2E)-2-methoxyimino-2-[2-(piperidin-1-ylmethyl)phenyl]acetate.
| Compound Name | methyl (2E)-2-methoxyimino-2-[2-(piperidin-1-ylmethyl)phenyl]acetate |
|---|---|
| PubChem CID | 10891589 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | methyl (2E)-2-methoxyimino-2-[2-(piperidin-1-ylmethyl)phenyl]acetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1CN1CCCCC1 |
| InChI | InChI=1S/C16H22N2O3/c1-20-16(19)15(17-21-2)14-9-5-4-8-13(14)12-18-10-6-3-7-11-18/h4-5,8-9H,3,6-7,10-12H2,1-2H3/b17-15+ |
| InChIKey | GCPSQVILMZGVLV-BMRADRMJSA-N |
| XLogP | 2.20 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|