C21H24N4O — CID 60602674
N'-[(2-cyanophenyl)methoxy]-2-(piperidin-1-ylmethyl)benzenecarboximidamide (PubChem CID 60602674) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N'-[(2-cyanophenyl)methoxy]-2-(piperidin-1-ylmethyl)benzenecarboximidamide.
| Compound Name | N'-[(2-cyanophenyl)methoxy]-2-(piperidin-1-ylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 60602674 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N'-[(2-cyanophenyl)methoxy]-2-(piperidin-1-ylmethyl)benzenecarboximidamide |
| SMILES | N#Cc1ccccc1CO/N=C(/N)c1ccccc1CN1CCCCC1 |
| InChI | InChI=1S/C21H24N4O/c22-14-17-8-2-3-10-19(17)16-26-24-21(23)20-11-5-4-9-18(20)15-25-12-6-1-7-13-25/h2-5,8-11H,1,6-7,12-13,15-16H2,(H2,23,24) |
| InChIKey | KVDVHPLHHUOGSZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|