C17H16FNO — CID 24725309
[2-(azetidin-1-ylmethyl)phenyl]-(3-fluorophenyl)methanone (PubChem CID 24725309) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is [2-(azetidin-1-ylmethyl)phenyl]-(3-fluorophenyl)methanone.
| Compound Name | [2-(azetidin-1-ylmethyl)phenyl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 24725309 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [2-(azetidin-1-ylmethyl)phenyl]-(3-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)c1ccccc1CN1CCC1 |
| InChI | InChI=1S/C17H16FNO/c18-15-7-3-6-13(11-15)17(20)16-8-2-1-5-14(16)12-19-9-4-10-19/h1-3,5-8,11H,4,9-10,12H2 |
| InChIKey | FDVQMVKDIMUHGY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |