C13H17N2NaO2 — CID 139934477
sodium 2-[(4-methylpiperazin-1-yl)methyl]benzoate (PubChem CID 139934477) has the molecular formula C13H17N2NaO2 and a molecular weight of 256.28 g/mol. Its IUPAC name is sodium 2-[(4-methylpiperazin-1-yl)methyl]benzoate.
| Compound Name | sodium 2-[(4-methylpiperazin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 139934477 |
| Molecular Formula | C13H17N2NaO2 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | sodium 2-[(4-methylpiperazin-1-yl)methyl]benzoate |
| SMILES | CN1CCN(Cc2ccccc2C(=O)[O-])CC1.[Na+] |
| InChI | InChI=1S/C13H18N2O2.Na/c1-14-6-8-15(9-7-14)10-11-4-2-3-5-12(11)13(16)17;/h2-5H,6-10H2,1H3,(H,16,17);/q;+1/p-1 |
| InChIKey | BCZOBDTXBOCESX-UHFFFAOYSA-M |
| XLogP | -3.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |