C35H50N4O — CID 73011693
bis[2-cyclopentyl-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone (PubChem CID 73011693) has the molecular formula C35H50N4O and a molecular weight of 542.81 g/mol. Its IUPAC name is bis[2-cyclopentyl-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone.
| Compound Name | bis[2-cyclopentyl-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 73011693 |
| Molecular Formula | C35H50N4O |
| Molecular Weight | 542.81 g/mol |
| Exact Mass | 542.40 |
| IUPAC Name | bis[2-cyclopentyl-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone |
| SMILES | CN1CCN(Cc2cccc(C(=O)c3cccc(CN4CCN(C)CC4)c3C3CCCC3)c2C2CCCC2)CC1 |
| InChI | InChI=1S/C35H50N4O/c1-36-17-21-38(22-18-36)25-29-13-7-15-31(33(29)27-9-3-4-10-27)35(40)32-16-8-14-30(34(32)28-11-5-6-12-28)26-39-23-19-37(2)20-24-39/h7-8,13-16,27-28H,3-6,9-12,17-26H2,1-2H3 |
| InChIKey | UNUDFAUVKZBYNC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.81 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |