C26H35N3O — CID 91118299
3-[2-(diethylaminomethyl)phenyl]-3-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-enal (PubChem CID 91118299) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is 3-[2-(diethylaminomethyl)phenyl]-3-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-enal.
| Compound Name | 3-[2-(diethylaminomethyl)phenyl]-3-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 91118299 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 3-[2-(diethylaminomethyl)phenyl]-3-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-enal |
| SMILES | CCN(CC)Cc1ccccc1C(=CC=O)c1ccccc1CN1CCN(C)CC1 |
| InChI | InChI=1S/C26H35N3O/c1-4-28(5-2)20-22-10-6-8-12-24(22)26(14-19-30)25-13-9-7-11-23(25)21-29-17-15-27(3)16-18-29/h6-14,19H,4-5,15-18,20-21H2,1-3H3 |
| InChIKey | KBZUIEJYJWEMAR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|