C11H15NS — CID 131107256
1-[(2-methylsulfanylphenyl)methyl]azetidine (PubChem CID 131107256) has the molecular formula C11H15NS and a molecular weight of 193.32 g/mol. Its IUPAC name is 1-[(2-methylsulfanylphenyl)methyl]azetidine.
| Compound Name | 1-[(2-methylsulfanylphenyl)methyl]azetidine |
|---|---|
| PubChem CID | 131107256 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.32 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-[(2-methylsulfanylphenyl)methyl]azetidine |
| SMILES | CSc1ccccc1CN1CCC1 |
| InChI | InChI=1S/C11H15NS/c1-13-11-6-3-2-5-10(11)9-12-7-4-8-12/h2-3,5-6H,4,7-9H2,1H3 |
| InChIKey | YDJPIHDFQWEXMN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |