C20H24N2O2 — CID 155146350
1-(2,2-diphenylethyl)-N-hydroxypiperidine-4-carboxamide (PubChem CID 155146350) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-(2,2-diphenylethyl)-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 155146350 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-(2,2-diphenylethyl)-N-hydroxypiperidine-4-carboxamide |
| SMILES | O=C(NO)C1CCN(CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N2O2/c23-20(21-24)18-11-13-22(14-12-18)15-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18-19,24H,11-15H2,(H,21,23) |
| InChIKey | XVWFBVNYUNWLBU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|