C23H26N2O — CID 51092869
N-(2,2-diphenylethyl)-1-prop-2-ynylpiperidine-4-carboxamide (PubChem CID 51092869) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-1-prop-2-ynylpiperidine-4-carboxamide.
| Compound Name | N-(2,2-diphenylethyl)-1-prop-2-ynylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 51092869 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-(2,2-diphenylethyl)-1-prop-2-ynylpiperidine-4-carboxamide |
| SMILES | C#CCN1CCC(C(=O)NCC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N2O/c1-2-15-25-16-13-21(14-17-25)23(26)24-18-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h1,3-12,21-22H,13-18H2,(H,24,26) |
| InChIKey | GJTOCYQXYWRWBZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|