C22H26N2O3 — CID 119254948
3-[(1-benzylpiperidine-4-carbonyl)amino]-2-phenylpropanoic acid (PubChem CID 119254948) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-[(1-benzylpiperidine-4-carbonyl)amino]-2-phenylpropanoic acid.
| Compound Name | 3-[(1-benzylpiperidine-4-carbonyl)amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 119254948 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-[(1-benzylpiperidine-4-carbonyl)amino]-2-phenylpropanoic acid |
| SMILES | O=C(NCC(C(=O)O)c1ccccc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N2O3/c25-21(23-15-20(22(26)27)18-9-5-2-6-10-18)19-11-13-24(14-12-19)16-17-7-3-1-4-8-17/h1-10,19-20H,11-16H2,(H,23,25)(H,26,27) |
| InChIKey | YNPDAZXOXXKCQE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |