C19H21NO3S — CID 134012964
N-(2,2-diphenylethyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 134012964) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(2,2-diphenylethyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 134012964 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(2,2-diphenylethyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21NO3S/c21-19(17-11-12-24(22,23)14-17)20-13-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2,(H,20,21) |
| InChIKey | SKGCEVXXBZDVPL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |