C16H17NO3S2 — CID 18090427
1,1-dioxo-N-[phenyl(thiophen-2-yl)methyl]thiolane-3-carboxamide (PubChem CID 18090427) has the molecular formula C16H17NO3S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1,1-dioxo-N-[phenyl(thiophen-2-yl)methyl]thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-[phenyl(thiophen-2-yl)methyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 18090427 |
| Molecular Formula | C16H17NO3S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1,1-dioxo-N-[phenyl(thiophen-2-yl)methyl]thiolane-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1cccs1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H17NO3S2/c18-16(13-8-10-22(19,20)11-13)17-15(14-7-4-9-21-14)12-5-2-1-3-6-12/h1-7,9,13,15H,8,10-11H2,(H,17,18) |
| InChIKey | DJIBQZWOSBAFDA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |