C18H19NO3S — CID 26691772
(3R)-N-benzhydryl-1,1-dioxothiolane-3-carboxamide (PubChem CID 26691772) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is (3R)-N-benzhydryl-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-benzhydryl-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 26691772 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (3R)-N-benzhydryl-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H19NO3S/c20-18(16-11-12-23(21,22)13-16)19-17(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2,(H,19,20)/t16-/m0/s1 |
| InChIKey | NBCXXTNCRPMOCY-INIZCTEOSA-N |
| XLogP | 2.33 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |