C16H21NO5S — CID 47071341
ethyl 2-[(1,1-dioxothiolane-3-carbonyl)amino]-3-phenylpropanoate (PubChem CID 47071341) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxothiolane-3-carbonyl)amino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[(1,1-dioxothiolane-3-carbonyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 47071341 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | ethyl 2-[(1,1-dioxothiolane-3-carbonyl)amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21NO5S/c1-2-22-16(19)14(10-12-6-4-3-5-7-12)17-15(18)13-8-9-23(20,21)11-13/h3-7,13-14H,2,8-11H2,1H3,(H,17,18) |
| InChIKey | RTLDCZMGKKTNEO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |