C12H16N2O3S — CID 39996283
(3R)-1,1-dioxo-N-[(1S)-1-pyridin-2-ylethyl]thiolane-3-carboxamide (PubChem CID 39996283) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is (3R)-1,1-dioxo-N-[(1S)-1-pyridin-2-ylethyl]thiolane-3-carboxamide.
| Compound Name | (3R)-1,1-dioxo-N-[(1S)-1-pyridin-2-ylethyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 39996283 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (3R)-1,1-dioxo-N-[(1S)-1-pyridin-2-ylethyl]thiolane-3-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1CCS(=O)(=O)C1)c1ccccn1 |
| InChI | InChI=1S/C12H16N2O3S/c1-9(11-4-2-3-6-13-11)14-12(15)10-5-7-18(16,17)8-10/h2-4,6,9-10H,5,7-8H2,1H3,(H,14,15)/t9-,10-/m0/s1 |
| InChIKey | ZPIGXTWUSXNYQH-UWVGGRQHSA-N |
| XLogP | 0.69 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |