C12H17N3O3S — CID 94148998
1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(1S)-1-pyridin-2-ylethyl]urea (PubChem CID 94148998) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(1S)-1-pyridin-2-ylethyl]urea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(1S)-1-pyridin-2-ylethyl]urea |
|---|---|
| PubChem CID | 94148998 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(1S)-1-pyridin-2-ylethyl]urea |
| SMILES | C[C@H](NC(=O)N[C@H]1CCS(=O)(=O)C1)c1ccccn1 |
| InChI | InChI=1S/C12H17N3O3S/c1-9(11-4-2-3-6-13-11)14-12(16)15-10-5-7-19(17,18)8-10/h2-4,6,9-10H,5,7-8H2,1H3,(H2,14,15,16)/t9-,10-/m0/s1 |
| InChIKey | FOBVYXGXRJBLNR-UWVGGRQHSA-N |
| XLogP | 0.63 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |