C13H19N3O — CID 36970112
1-[(1S)-1-cyclopropylethyl]-3-[(1S)-1-pyridin-2-ylethyl]urea (PubChem CID 36970112) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-[(1S)-1-cyclopropylethyl]-3-[(1S)-1-pyridin-2-ylethyl]urea.
| Compound Name | 1-[(1S)-1-cyclopropylethyl]-3-[(1S)-1-pyridin-2-ylethyl]urea |
|---|---|
| PubChem CID | 36970112 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-[(1S)-1-cyclopropylethyl]-3-[(1S)-1-pyridin-2-ylethyl]urea |
| SMILES | C[C@H](NC(=O)N[C@@H](C)C1CC1)c1ccccn1 |
| InChI | InChI=1S/C13H19N3O/c1-9(11-6-7-11)15-13(17)16-10(2)12-5-3-4-8-14-12/h3-5,8-11H,6-7H2,1-2H3,(H2,15,16,17)/t9-,10-/m0/s1 |
| InChIKey | LCSKDHAOQPQIAV-UWVGGRQHSA-N |
| XLogP | 2.24 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |