C13H20N4O3S — CID 131962718
1-(1,1-dioxothiolan-3-yl)-3-[3-(pyridin-2-ylamino)propyl]urea (PubChem CID 131962718) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[3-(pyridin-2-ylamino)propyl]urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[3-(pyridin-2-ylamino)propyl]urea |
|---|---|
| PubChem CID | 131962718 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[3-(pyridin-2-ylamino)propyl]urea |
| SMILES | O=C(NCCCNc1ccccn1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H20N4O3S/c18-13(17-11-5-9-21(19,20)10-11)16-8-3-7-15-12-4-1-2-6-14-12/h1-2,4,6,11H,3,5,7-10H2,(H,14,15)(H2,16,17,18) |
| InChIKey | UGPARWGUDZMWOX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|