C12H17NO3S — CID 66460317
1-(1,1-dioxothiolan-3-yl)-2-pyridin-2-ylpropan-1-ol (PubChem CID 66460317) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-pyridin-2-ylpropan-1-ol.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-pyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 66460317 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-pyridin-2-ylpropan-1-ol |
| SMILES | CC(c1ccccn1)C(O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17NO3S/c1-9(11-4-2-3-6-13-11)12(14)10-5-7-17(15,16)8-10/h2-4,6,9-10,12,14H,5,7-8H2,1H3 |
| InChIKey | GCYGWHFDGPIMNX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |