C13H17N3O4S — CID 77050060
N-(2-amino-2-hydroxyimino-1-phenylethyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 77050060) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyimino-1-phenylethyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(2-amino-2-hydroxyimino-1-phenylethyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 77050060 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2-amino-2-hydroxyimino-1-phenylethyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | NC(=NO)C(NC(=O)C1CCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O4S/c14-12(16-18)11(9-4-2-1-3-5-9)15-13(17)10-6-7-21(19,20)8-10/h1-5,10-11,18H,6-8H2,(H2,14,16)(H,15,17) |
| InChIKey | JRYPTMLHXPRCOR-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|