C26H23Cl2F3N4O3 — CID 1477813
2-chloro-3-[4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]piperidin-1-yl]naphthalene-1,4-dione (PubChem CID 1477813) has the molecular formula C26H23Cl2F3N4O3 and a molecular weight of 567.40 g/mol. Its IUPAC name is 2-chloro-3-[4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]piperidin-1-yl]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]piperidin-1-yl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 1477813 |
| Molecular Formula | C26H23Cl2F3N4O3 |
| Molecular Weight | 567.40 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 2-chloro-3-[4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]piperidin-1-yl]naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(N2CCC(C(=O)N3CCN(c4ncc(C(F)(F)F)cc4Cl)CC3)CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H23Cl2F3N4O3/c27-19-13-16(26(29,30)31)14-32-24(19)34-9-11-35(12-10-34)25(38)15-5-7-33(8-6-15)21-20(28)22(36)17-3-1-2-4-18(17)23(21)37/h1-4,13-15H,5-12H2 |
| InChIKey | BSFRNHWGAKYBGY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|