C24H23ClN2O6S — CID 4587576
ethyl 1-[3-[(4-chlorophenyl)sulfonylamino]-1,4-dioxonaphthalen-2-yl]piperidine-4-carboxylate (PubChem CID 4587576) has the molecular formula C24H23ClN2O6S and a molecular weight of 502.98 g/mol. Its IUPAC name is ethyl 1-[3-[(4-chlorophenyl)sulfonylamino]-1,4-dioxonaphthalen-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[(4-chlorophenyl)sulfonylamino]-1,4-dioxonaphthalen-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4587576 |
| Molecular Formula | C24H23ClN2O6S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | ethyl 1-[3-[(4-chlorophenyl)sulfonylamino]-1,4-dioxonaphthalen-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2=C(NS(=O)(=O)c3ccc(Cl)cc3)C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C24H23ClN2O6S/c1-2-33-24(30)15-11-13-27(14-12-15)21-20(22(28)18-5-3-4-6-19(18)23(21)29)26-34(31,32)17-9-7-16(25)8-10-17/h3-10,15,26H,2,11-14H2,1H3 |
| InChIKey | ZUBPUHSFDONZHL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|