C16H14ClN5O — CID 172979697
(1Z)-2-amino-N-[2-chloro-6-(2-hydroxy-3-methylphenyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172979697) has the molecular formula C16H14ClN5O and a molecular weight of 327.78 g/mol. Its IUPAC name is (1Z)-2-amino-N-[2-chloro-6-(2-hydroxy-3-methylphenyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[2-chloro-6-(2-hydroxy-3-methylphenyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979697 |
| Molecular Formula | C16H14ClN5O |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (1Z)-2-amino-N-[2-chloro-6-(2-hydroxy-3-methylphenyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(Cl)cccc1-c1cccc(C)c1O |
| InChI | InChI=1S/C16H14ClN5O/c1-9-4-2-6-11(15(9)23)10-5-3-7-12(17)14(10)22-21-13(8-18)16(19)20/h2-7,22-23H,1H3,(H3,19,20)/b21-13+ |
| InChIKey | NBIJZAZQKUOKMJ-FYJGNVAPSA-N |
| XLogP | 3.25 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|