C33H27ClN8NaO6S+ — CID 135534319
sodium 5-[[4-[4-[[2,4-diamino-3-[(4-chloro-5-methyl-2-sulfophenyl)diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 135534319) has the molecular formula C33H27ClN8NaO6S+ and a molecular weight of 722.14 g/mol. Its IUPAC name is sodium 5-[[4-[4-[[2,4-diamino-3-[(4-chloro-5-methyl-2-sulfophenyl)diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | sodium 5-[[4-[4-[[2,4-diamino-3-[(4-chloro-5-methyl-2-sulfophenyl)diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135534319 |
| Molecular Formula | C33H27ClN8NaO6S+ |
| Molecular Weight | 722.14 g/mol |
| Exact Mass | 721.14 |
| IUPAC Name | sodium 5-[[4-[4-[[2,4-diamino-3-[(4-chloro-5-methyl-2-sulfophenyl)diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Cc1cc(/N=N/c2c(N)c(C)cc(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)c(C(=O)O)c5)cc4)cc3)c2N)c(S(=O)(=O)O)cc1Cl.[Na+] |
| InChI | InChI=1S/C33H27ClN8O6S.Na/c1-17-13-26(29(16-25(17)34)49(46,47)48)40-42-32-30(35)18(2)14-27(31(32)36)41-38-22-9-5-20(6-10-22)19-3-7-21(8-4-19)37-39-23-11-12-28(43)24(15-23)33(44)45;/h3-16,43H,35-36H2,1-2H3,(H,44,45)(H,46,47,48);/q;+1/b39-37+,41-38+,42-40+; |
| InChIKey | PTVYFNNFTTXYKC-XABRKTGBSA-N |
| XLogP | 6.69 |
| TPSA | 238.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.14 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|