C34H30N8O6S — CID 6335858
(3Z)-3-[[4-[4-[[2,6-diamino-3-methyl-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-methylphenyl]-2-methylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 6335858) has the molecular formula C34H30N8O6S and a molecular weight of 678.73 g/mol. Its IUPAC name is (3Z)-3-[[4-[4-[[2,6-diamino-3-methyl-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-methylphenyl]-2-methylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | (3Z)-3-[[4-[4-[[2,6-diamino-3-methyl-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-methylphenyl]-2-methylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 6335858 |
| Molecular Formula | C34H30N8O6S |
| Molecular Weight | 678.73 g/mol |
| Exact Mass | 678.20 |
| IUPAC Name | (3Z)-3-[[4-[4-[[2,6-diamino-3-methyl-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-methylphenyl]-2-methylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | Cc1cc(-c2ccc(N/N=C3/C=CC(=O)C(C(=O)O)=C3)c(C)c2)ccc1/N=N/c1c(N)c(C)cc(/N=N/c2ccc(S(=O)(=O)O)cc2)c1N |
| InChI | InChI=1S/C34H30N8O6S/c1-18-14-21(4-11-27(18)39-38-24-8-13-30(43)26(17-24)34(44)45)22-5-12-28(19(2)15-22)40-42-33-31(35)20(3)16-29(32(33)36)41-37-23-6-9-25(10-7-23)49(46,47)48/h4-17,39H,35-36H2,1-3H3,(H,44,45)(H,46,47,48)/b38-24-,41-37+,42-40+ |
| InChIKey | YQQQLGUPOHYGKN-SRQSZGOOSA-N |
| XLogP | 7.44 |
| TPSA | 234.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|