C33H28N8O3S — CID 6111849
(3E)-3-[[4-[4-[[2,4-diamino-5-methyl-3-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenyl]sulfanylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 6111849) has the molecular formula C33H28N8O3S and a molecular weight of 616.71 g/mol. Its IUPAC name is (3E)-3-[[4-[4-[[2,4-diamino-5-methyl-3-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenyl]sulfanylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | (3E)-3-[[4-[4-[[2,4-diamino-5-methyl-3-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenyl]sulfanylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 6111849 |
| Molecular Formula | C33H28N8O3S |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | (3E)-3-[[4-[4-[[2,4-diamino-5-methyl-3-[(4-methylphenyl)diazenyl]phenyl]diazenyl]phenyl]sulfanylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | Cc1ccc(/N=N/c2c(N)c(C)cc(/N=N/c3ccc(Sc4ccc(N/N=C5\C=CC(=O)C(C(=O)O)=C5)cc4)cc3)c2N)cc1 |
| InChI | InChI=1S/C33H28N8O3S/c1-19-3-5-21(6-4-19)38-41-32-30(34)20(2)17-28(31(32)35)40-37-23-9-14-26(15-10-23)45-25-12-7-22(8-13-25)36-39-24-11-16-29(42)27(18-24)33(43)44/h3-18,36H,34-35H2,1-2H3,(H,43,44)/b39-24+,40-37+,41-38+ |
| InChIKey | XUKXIDXEQXJIMP-MQVQQUHPSA-N |
| XLogP | 8.37 |
| TPSA | 180.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|