C38H30N8O6S — CID 6823276
3-[[4-[4-[[2,4-diamino-5-methyl-3-[[4-(4-sulfophenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 6823276) has the molecular formula C38H30N8O6S and a molecular weight of 726.78 g/mol. Its IUPAC name is 3-[[4-[4-[[2,4-diamino-5-methyl-3-[[4-(4-sulfophenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | 3-[[4-[4-[[2,4-diamino-5-methyl-3-[[4-(4-sulfophenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 6823276 |
| Molecular Formula | C38H30N8O6S |
| Molecular Weight | 726.78 g/mol |
| Exact Mass | 726.20 |
| IUPAC Name | 3-[[4-[4-[[2,4-diamino-5-methyl-3-[[4-(4-sulfophenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | Cc1cc(/N=N/c2ccc(-c3ccc(NN=C4C=CC(=O)C(C(=O)O)=C4)cc3)cc2)c(N)c(/N=N/c2ccc(-c3ccc(S(=O)(=O)O)cc3)cc2)c1N |
| InChI | InChI=1S/C38H30N8O6S/c1-22-20-33(36(40)37(35(22)39)46-43-29-14-6-25(7-15-29)26-8-17-31(18-9-26)53(50,51)52)45-42-28-12-4-24(5-13-28)23-2-10-27(11-3-23)41-44-30-16-19-34(47)32(21-30)38(48)49/h2-21,41H,39-40H2,1H3,(H,48,49)(H,50,51,52)/b44-30?,45-42+,46-43+ |
| InChIKey | TYGXHPQAUWHEJG-TYSBDCSNSA-N |
| XLogP | 8.49 |
| TPSA | 234.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.78 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|