C36H28N8O6S2 — CID 6176391
(3E)-3-[[4-[4-[[2,4-diamino-5-methyl-3-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]phenyl]sulfanylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 6176391) has the molecular formula C36H28N8O6S2 and a molecular weight of 732.80 g/mol. Its IUPAC name is (3E)-3-[[4-[4-[[2,4-diamino-5-methyl-3-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]phenyl]sulfanylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | (3E)-3-[[4-[4-[[2,4-diamino-5-methyl-3-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]phenyl]sulfanylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 6176391 |
| Molecular Formula | C36H28N8O6S2 |
| Molecular Weight | 732.80 g/mol |
| Exact Mass | 732.16 |
| IUPAC Name | (3E)-3-[[4-[4-[[2,4-diamino-5-methyl-3-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]phenyl]sulfanylphenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | Cc1cc(/N=N/c2ccc(Sc3ccc(N/N=C4\C=CC(=O)C(C(=O)O)=C4)cc3)cc2)c(N)c(/N=N/c2ccc(S(=O)(=O)O)c3ccccc23)c1N |
| InChI | InChI=1S/C36H28N8O6S2/c1-20-18-30(34(38)35(33(20)37)44-42-29-15-17-32(52(48,49)50)27-5-3-2-4-26(27)29)43-40-22-8-13-25(14-9-22)51-24-11-6-21(7-12-24)39-41-23-10-16-31(45)28(19-23)36(46)47/h2-19,39H,37-38H2,1H3,(H,46,47)(H,48,49,50)/b41-23+,43-40+,44-42+ |
| InChIKey | HJNVJVISIGAGPK-KXQJMGCVSA-N |
| XLogP | 8.46 |
| TPSA | 234.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.80 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|