C33H26N8O5 — CID 6811512
3-[[4-[4-[[2,4-diamino-3-[(3-carboxyphenyl)diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 6811512) has the molecular formula C33H26N8O5 and a molecular weight of 614.62 g/mol. Its IUPAC name is 3-[[4-[4-[[2,4-diamino-3-[(3-carboxyphenyl)diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | 3-[[4-[4-[[2,4-diamino-3-[(3-carboxyphenyl)diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 6811512 |
| Molecular Formula | C33H26N8O5 |
| Molecular Weight | 614.62 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | 3-[[4-[4-[[2,4-diamino-3-[(3-carboxyphenyl)diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | Cc1cc(/N=N/c2ccc(-c3ccc(NN=C4C=CC(=O)C(C(=O)O)=C4)cc3)cc2)c(N)c(/N=N/c2cccc(C(=O)O)c2)c1N |
| InChI | InChI=1S/C33H26N8O5/c1-18-15-27(30(35)31(29(18)34)41-39-24-4-2-3-21(16-24)32(43)44)40-37-23-11-7-20(8-12-23)19-5-9-22(10-6-19)36-38-25-13-14-28(42)26(17-25)33(45)46/h2-17,36H,34-35H2,1H3,(H,43,44)(H,45,46)/b38-25?,40-37+,41-39+ |
| InChIKey | RPHKOVFOEITVBD-GJQAUBFQSA-N |
| XLogP | 7.27 |
| TPSA | 217.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.62 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|