C29H25ClN6O8S — CID 170846954
(3Z)-3-[[4-[[N-[4-[(4-chloro-3-sulfophenyl)diazenyl]-2-ethoxy-5-methylphenyl]-C-hydroxycarbonimidoyl]amino]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 170846954) has the molecular formula C29H25ClN6O8S and a molecular weight of 653.07 g/mol. Its IUPAC name is (3Z)-3-[[4-[[N-[4-[(4-chloro-3-sulfophenyl)diazenyl]-2-ethoxy-5-methylphenyl]-C-hydroxycarbonimidoyl]amino]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | (3Z)-3-[[4-[[N-[4-[(4-chloro-3-sulfophenyl)diazenyl]-2-ethoxy-5-methylphenyl]-C-hydroxycarbonimidoyl]amino]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 170846954 |
| Molecular Formula | C29H25ClN6O8S |
| Molecular Weight | 653.07 g/mol |
| Exact Mass | 652.11 |
| IUPAC Name | (3Z)-3-[[4-[[N-[4-[(4-chloro-3-sulfophenyl)diazenyl]-2-ethoxy-5-methylphenyl]-C-hydroxycarbonimidoyl]amino]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | CCOc1cc(/N=N/c2ccc(Cl)c(S(=O)(=O)O)c2)c(C)cc1/N=C(\O)Nc1ccc(N/N=C2/C=CC(=O)C(C(=O)O)=C2)cc1 |
| InChI | InChI=1S/C29H25ClN6O8S/c1-3-44-26-15-23(36-35-20-8-10-22(30)27(14-20)45(41,42)43)16(2)12-24(26)32-29(40)31-17-4-6-18(7-5-17)33-34-19-9-11-25(37)21(13-19)28(38)39/h4-15,33H,3H2,1-2H3,(H,38,39)(H2,31,32,40)(H,41,42,43)/b34-19-,36-35+ |
| InChIKey | RHAJDERUUBVNQV-FKGGZSGFSA-N |
| XLogP | 6.28 |
| TPSA | 211.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.07 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|