C31H30N8Na2O11S2 — CID 170840483
CID 170840483 (PubChem CID 170840483) has the molecular formula C31H30N8Na2O11S2 and a molecular weight of 800.74 g/mol.
| Compound Name | CID 170840483 |
|---|---|
| PubChem CID | 170840483 |
| Molecular Formula | C31H30N8Na2O11S2 |
| Molecular Weight | 800.74 g/mol |
| Exact Mass | 800.13 |
| IUPAC Name | — |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=C(\O)Nc3ccc(/N=N/c4ccc(C)c(S(=O)(=O)O)c4)c(/N=C(\O)CO)c3)cc2/N=C(\O)CO)cc1S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C31H30N8O11S2.2Na/c1-17-3-5-21(13-27(17)51(45,46)47)36-38-23-9-7-19(11-25(23)34-29(42)15-40)32-31(44)33-20-8-10-24(26(12-20)35-30(43)16-41)39-37-22-6-4-18(2)28(14-22)52(48,49)50;;/h3-14,40-41H,15-16H2,1-2H3,(H,34,42)(H,35,43)(H2,32,33,44)(H,45,46,47)(H,48,49,50);;/b38-36+,39-37+;; |
| InChIKey | QTSIINYFEHTSHG-PYIFGEPISA-N |
| XLogP | 5.68 |
| TPSA | 308.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|