C14H12ClNO4S — CID 139946842
5-[(4-chlorobenzoyl)amino]-2-methylbenzenesulfonic acid (PubChem CID 139946842) has the molecular formula C14H12ClNO4S and a molecular weight of 325.77 g/mol. Its IUPAC name is 5-[(4-chlorobenzoyl)amino]-2-methylbenzenesulfonic acid.
| Compound Name | 5-[(4-chlorobenzoyl)amino]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 139946842 |
| Molecular Formula | C14H12ClNO4S |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-[(4-chlorobenzoyl)amino]-2-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(Cl)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C14H12ClNO4S/c1-9-2-7-12(8-13(9)21(18,19)20)16-14(17)10-3-5-11(15)6-4-10/h2-8H,1H3,(H,16,17)(H,18,19,20) |
| InChIKey | XENQWUBRNMBPRE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|