C37H28N6O8S2 — CID 71440542
7-[[4-[[5-[(4-benzamidobenzoyl)amino]-2-methylphenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 71440542) has the molecular formula C37H28N6O8S2 and a molecular weight of 748.80 g/mol. Its IUPAC name is 7-[[4-[[5-[(4-benzamidobenzoyl)amino]-2-methylphenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[4-[[5-[(4-benzamidobenzoyl)amino]-2-methylphenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 71440542 |
| Molecular Formula | C37H28N6O8S2 |
| Molecular Weight | 748.80 g/mol |
| Exact Mass | 748.14 |
| IUPAC Name | 7-[[4-[[5-[(4-benzamidobenzoyl)amino]-2-methylphenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc1/N=N/c1ccc(/N=N/c2ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3c2)cc1 |
| InChI | InChI=1S/C37H28N6O8S2/c1-23-7-11-30(39-37(45)25-8-12-27(13-9-25)38-36(44)24-5-3-2-4-6-24)21-34(23)43-41-29-17-15-28(16-18-29)40-42-31-14-10-26-19-32(52(46,47)48)22-35(33(26)20-31)53(49,50)51/h2-22H,1H3,(H,38,44)(H,39,45)(H,46,47,48)(H,49,50,51)/b42-40+,43-41+ |
| InChIKey | ZHYZSXQKVQFREL-IZRQRQPJSA-N |
| XLogP | 8.98 |
| TPSA | 216.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.80 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|