C37H28N8O6S — CID 6522978
(3Z)-3-[[4-[4-[[2,4-diamino-3-[(4-phenylphenyl)diazenyl]-5-sulfophenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 6522978) has the molecular formula C37H28N8O6S and a molecular weight of 712.75 g/mol. Its IUPAC name is (3Z)-3-[[4-[4-[[2,4-diamino-3-[(4-phenylphenyl)diazenyl]-5-sulfophenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | (3Z)-3-[[4-[4-[[2,4-diamino-3-[(4-phenylphenyl)diazenyl]-5-sulfophenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 6522978 |
| Molecular Formula | C37H28N8O6S |
| Molecular Weight | 712.75 g/mol |
| Exact Mass | 712.19 |
| IUPAC Name | (3Z)-3-[[4-[4-[[2,4-diamino-3-[(4-phenylphenyl)diazenyl]-5-sulfophenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(N/N=C4/C=CC(=O)C(C(=O)O)=C4)cc3)cc2)cc(S(=O)(=O)O)c(N)c1/N=N/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H28N8O6S/c38-34-31(21-33(52(49,50)51)35(39)36(34)45-42-28-16-6-23(7-17-28)22-4-2-1-3-5-22)44-41-27-14-10-25(11-15-27)24-8-12-26(13-9-24)40-43-29-18-19-32(46)30(20-29)37(47)48/h1-21,40H,38-39H2,(H,47,48)(H,49,50,51)/b43-29-,44-41+,45-42+ |
| InChIKey | RJLQOBRDAYNVRX-PBSPSJAHSA-N |
| XLogP | 8.18 |
| TPSA | 234.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.75 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|