C31H23N5O10S — CID 135827506
5-[[4-[[7-(1-carboxyethylamino)-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]naphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 135827506) has the molecular formula C31H23N5O10S and a molecular weight of 657.62 g/mol. Its IUPAC name is 5-[[4-[[7-(1-carboxyethylamino)-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]naphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4-[[7-(1-carboxyethylamino)-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]naphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 135827506 |
| Molecular Formula | C31H23N5O10S |
| Molecular Weight | 657.62 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | 5-[[4-[[7-(1-carboxyethylamino)-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]naphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | CC(Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccc(/N=N/c4cc(C(=O)O)cc(C(=O)O)c4)c4ccccc34)c(O)c2c1)C(=O)O |
| InChI | InChI=1S/C31H23N5O10S/c1-15(29(38)39)32-19-7-6-16-13-26(47(44,45)46)27(28(37)23(16)14-19)36-35-25-9-8-24(21-4-2-3-5-22(21)25)34-33-20-11-17(30(40)41)10-18(12-20)31(42)43/h2-15,32,37H,1H3,(H,38,39)(H,40,41)(H,42,43)(H,44,45,46)/b34-33+,36-35+ |
| InChIKey | YQEHLRNLLHXXOE-WXBFSDFVSA-N |
| XLogP | 7.06 |
| TPSA | 247.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.62 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|