C37H27N5O12S — CID 163522507
4-[[4-[[7-(4-carboxyanilino)-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-2,6-dicarboxylic acid (PubChem CID 163522507) has the molecular formula C37H27N5O12S and a molecular weight of 765.71 g/mol. Its IUPAC name is 4-[[4-[[7-(4-carboxyanilino)-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-2,6-dicarboxylic acid.
| Compound Name | 4-[[4-[[7-(4-carboxyanilino)-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 163522507 |
| Molecular Formula | C37H27N5O12S |
| Molecular Weight | 765.71 g/mol |
| Exact Mass | 765.14 |
| IUPAC Name | 4-[[4-[[7-(4-carboxyanilino)-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-2,6-dicarboxylic acid |
| SMILES | COc1cc(/N=N/c2cc(C(=O)O)cc3ccc(C(=O)O)cc23)c(OC)cc1/N=N/c1c(S(=O)(=O)O)cc2ccc(Nc3ccc(C(=O)O)cc3)cc2c1O |
| InChI | InChI=1S/C37H27N5O12S/c1-53-30-17-29(31(54-2)16-28(30)40-39-27-13-22(37(48)49)11-19-3-4-21(36(46)47)12-25(19)27)41-42-33-32(55(50,51)52)14-20-7-10-24(15-26(20)34(33)43)38-23-8-5-18(6-9-23)35(44)45/h3-17,38,43H,1-2H3,(H,44,45)(H,46,47)(H,48,49)(H,50,51,52)/b40-39+,42-41+ |
| InChIKey | DMAYEQBGHUJLTG-HHKNSCEGSA-N |
| XLogP | 8.63 |
| TPSA | 266.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.71 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|