C40H26N6Na2O10S2 — CID 101227538
disodium;7-[[4-[(8-oxido-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)carbamoyl]benzoyl]amino]-2-phenyldiazenyl-3-sulfonaphthalen-1-olate (PubChem CID 101227538) has the molecular formula C40H26N6Na2O10S2 and a molecular weight of 860.79 g/mol. Its IUPAC name is disodium;7-[[4-[(8-oxido-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)carbamoyl]benzoyl]amino]-2-phenyldiazenyl-3-sulfonaphthalen-1-olate.
| Compound Name | disodium;7-[[4-[(8-oxido-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)carbamoyl]benzoyl]amino]-2-phenyldiazenyl-3-sulfonaphthalen-1-olate |
|---|---|
| PubChem CID | 101227538 |
| Molecular Formula | C40H26N6Na2O10S2 |
| Molecular Weight | 860.79 g/mol |
| Exact Mass | 860.09 |
| IUPAC Name | disodium;7-[[4-[(8-oxido-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)carbamoyl]benzoyl]amino]-2-phenyldiazenyl-3-sulfonaphthalen-1-olate |
| SMILES | O=C(Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c([O-])c2c1)c1ccc(C(=O)Nc2ccc3cc(S(=O)(=O)O)c(/N=N/c4ccccc4)c([O-])c3c2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C40H28N6O10S2.2Na/c47-37-31-21-29(17-15-25(31)19-33(57(51,52)53)35(37)45-43-27-7-3-1-4-8-27)41-39(49)23-11-13-24(14-12-23)40(50)42-30-18-16-26-20-34(58(54,55)56)36(38(48)32(26)22-30)46-44-28-9-5-2-6-10-28;;/h1-22,47-48H,(H,41,49)(H,42,50)(H,51,52,53)(H,54,55,56);;/q;2*+1/p-2/b45-43+,46-44+;; |
| InChIKey | DVJFWEYLGCWTTK-KDUZSUQQSA-L |
| XLogP | 1.98 |
| TPSA | 262.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.79 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|