C22H15N5O9S — CID 166844010
7-anilino-4-hydroxy-3-[(2-hydroxy-3,5-dinitrophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 166844010) has the molecular formula C22H15N5O9S and a molecular weight of 525.46 g/mol. Its IUPAC name is 7-anilino-4-hydroxy-3-[(2-hydroxy-3,5-dinitrophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-4-hydroxy-3-[(2-hydroxy-3,5-dinitrophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 166844010 |
| Molecular Formula | C22H15N5O9S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.06 |
| IUPAC Name | 7-anilino-4-hydroxy-3-[(2-hydroxy-3,5-dinitrophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | O=[N+]([O-])c1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(Nc4ccccc4)ccc3c2O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H15N5O9S/c28-21-16-7-6-14(23-13-4-2-1-3-5-13)8-12(16)9-19(37(34,35)36)20(21)25-24-17-10-15(26(30)31)11-18(22(17)29)27(32)33/h1-11,23,28-29H,(H,34,35,36)/b25-24+ |
| InChIKey | ZTRYALNUIIYUGL-OCOZRVBESA-N |
| XLogP | 5.47 |
| TPSA | 217.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|