C18H16N2O8S2Se2 — CID 168831732
3-oxo-2-[4-[3-oxo-5-(trioxidanylsulfanyl)-1,2-benzoselenazol-2-yl]butyl]-1,2-benzoselenazole-5-sulfonic acid (PubChem CID 168831732) has the molecular formula C18H16N2O8S2Se2 and a molecular weight of 610.39 g/mol. Its IUPAC name is 3-oxo-2-[4-[3-oxo-5-(trioxidanylsulfanyl)-1,2-benzoselenazol-2-yl]butyl]-1,2-benzoselenazole-5-sulfonic acid.
| Compound Name | 3-oxo-2-[4-[3-oxo-5-(trioxidanylsulfanyl)-1,2-benzoselenazol-2-yl]butyl]-1,2-benzoselenazole-5-sulfonic acid |
|---|---|
| PubChem CID | 168831732 |
| Molecular Formula | C18H16N2O8S2Se2 |
| Molecular Weight | 610.39 g/mol |
| Exact Mass | 611.87 |
| IUPAC Name | 3-oxo-2-[4-[3-oxo-5-(trioxidanylsulfanyl)-1,2-benzoselenazol-2-yl]butyl]-1,2-benzoselenazole-5-sulfonic acid |
| SMILES | O=c1c2cc(SOOO)ccc2[se]n1CCCCn1[se]c2ccc(S(=O)(=O)O)cc2c1=O |
| InChI | InChI=1S/C18H16N2O8S2Se2/c21-17-13-9-11(29-28-27-23)3-5-15(13)31-19(17)7-1-2-8-20-18(22)14-10-12(30(24,25)26)4-6-16(14)32-20/h3-6,9-10,23H,1-2,7-8H2,(H,24,25,26) |
| InChIKey | JCAQHRMNJADCLR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|