C24H18N4O12S4 — CID 20615617
6-[[2-[[5,7-bis(trioxidanylsulfanyl)naphthalen-2-yl]amino]pyrimidin-4-yl]amino]naphthalene-1,3-disulfonic acid (PubChem CID 20615617) has the molecular formula C24H18N4O12S4 and a molecular weight of 682.69 g/mol. Its IUPAC name is 6-[[2-[[5,7-bis(trioxidanylsulfanyl)naphthalen-2-yl]amino]pyrimidin-4-yl]amino]naphthalene-1,3-disulfonic acid.
| Compound Name | 6-[[2-[[5,7-bis(trioxidanylsulfanyl)naphthalen-2-yl]amino]pyrimidin-4-yl]amino]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 20615617 |
| Molecular Formula | C24H18N4O12S4 |
| Molecular Weight | 682.69 g/mol |
| Exact Mass | 681.98 |
| IUPAC Name | 6-[[2-[[5,7-bis(trioxidanylsulfanyl)naphthalen-2-yl]amino]pyrimidin-4-yl]amino]naphthalene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2ccc(Nc3ccnc(Nc4ccc5c(SOOO)cc(SOOO)cc5c4)n3)cc2c1 |
| InChI | InChI=1S/C24H18N4O12S4/c29-37-39-41-17-9-13-7-16(1-3-19(13)21(11-17)42-40-38-30)27-24-25-6-5-23(28-24)26-15-2-4-20-14(8-15)10-18(43(31,32)33)12-22(20)44(34,35)36/h1-12,29-30H,(H,31,32,33)(H,34,35,36)(H2,25,26,27,28) |
| InChIKey | FOOFNGJYSLFMTO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 235.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|